mirrors/PocketMine-MP
1
0
Fork 0
mirror of https://github.com/pmmp/PocketMine-MP.git synced 2025-04-20 16:00:20 +00:00
Code Issues Projects Releases Wiki Activity

Fixed entity physics

Browse Source
This commit is contained in:
Shoghi Cervantes 2014-08-28 18:26:37 +02:00
parent eab86f5f90
commit 9fb46d8fe8
3 changed files with 202 additions and 137 deletions
Show Stats Download Patch File Download Diff File Expand all files Collapse all files

2
src/pocketmine/Player.php
View File

@ -1517,7 +1517,7 @@ class Player extends Human implements CommandSender, InventoryHolder, IPlayer{
case 5: //Shot arrow
//if($this->entity->inAction === true){
if($this->inventory->getItemInHand()->getID() === Item::BOW){
$f = 1 * 2 * 1.5;
$f = 1.5;
$nbt = new Compound("", [
"Pos" => new Enum("Pos", [
new Double("", $this->x),

284
src/pocketmine/entity/Entity.php
View File

@ -169,13 +169,10 @@ abstract class Entity extends Position implements Metadatable{
$this->namedtag["Pos"][2]
),
$this->namedtag->Rotation[0],
$this->namedtag->Rotation[1]
);
$this->setMotion(new Vector3(
$this->namedtag["Motion"][0],
$this->namedtag["Motion"][1],
$this->namedtag["Motion"][2])
$this->namedtag->Rotation[1],
true
);
$this->setMotion(new Vector3($this->namedtag["Motion"][0], $this->namedtag["Motion"][1], $this->namedtag["Motion"][2]));
if(!isset($this->namedtag->FallDistance)){
$this->namedtag->FallDistance = new Float("FallDistance", 0);
@ -206,8 +203,9 @@ abstract class Entity extends Position implements Metadatable{
$this->getLevel()->addEntity($this);
$this->initEntity();
$this->lastUpdate = $this->spawnTime = microtime(true);
$this->justCreated = false;
$this->server->getPluginManager()->callEvent(new EntitySpawnEvent($this));
$this->onUpdate();
$this->justCreated = false;
$this->scheduleUpdate();
}
@ -360,7 +358,7 @@ abstract class Entity extends Position implements Metadatable{
}
public function canCollideWith(Entity $entity){
return true;
return !$this->justCreated;
}
protected function checkObstruction($x, $y, $z){
@ -715,91 +713,66 @@ abstract class Entity extends Position implements Metadatable{
}
public function move($dx, $dy, $dz){
//$collision = [];
//$this->checkBlockCollision($collision);
if($dx == 0 and $dz == 0 and $dy == 0){
return;
}
if($this->inBlock){
$this->boundingBox->offset($dx, $dy, $dz);
$this->x = ($this->boundingBox->minX + $this->boundingBox->maxX) / 2;
$this->y = $this->boundingBox->minY + $this->height;
$this->z = ($this->boundingBox->minZ + $this->boundingBox->maxZ) / 2;
}else{
//$collision = [];
//$this->checkBlockCollision($collision);
if($dx == 0 and $dz == 0 and $dy == 0){
return;
}
Timings::$entityMoveTimer->startTiming();
Timings::$entityMoveTimer->startTiming();
$ox = $this->x;
$oy = $this->y;
$oz = $this->z;
$ox = $this->x;
$oy = $this->y;
$oz = $this->z;
if($this->isColliding){ //With an entity
$this->isColliding = false;
$dx *= 0.25;
$dy *= 0.05;
$dz *= 0.25;
$this->motionX = 0;
$this->motionY = 0;
$this->motionZ = 0;
}
if($this->isColliding){ //With an entity
$this->isColliding = false;
$dx *= 0.25;
$dy *= 0.05;
$dz *= 0.25;
$this->motionX = 0;
$this->motionY = 0;
$this->motionZ = 0;
}
$movX = $dx;
$movY = $dy;
$movZ = $dz;
$movX = $dx;
$movY = $dy;
$movZ = $dz;
/*$sneakFlag = $this->onGround and $this instanceof Player;
$axisalignedbb = clone $this->boundingBox;
if($sneakFlag){
for($mov = 0.05; $dx != 0.0 and count($this->getLevel()->getCollisionCubes($this, $this->boundingBox->getOffsetBoundingBox($dx, -1, 0))) === 0; $movX = $dx){
if($dx < $mov and $dx >= -$mov){
$dx = 0;
}elseif($dx > 0){
$dx -= $mov;
}else{
$dx += $mov;
/*$sneakFlag = $this->onGround and $this instanceof Player;
if($sneakFlag){
for($mov = 0.05; $dx != 0.0 and count($this->getLevel()->getCollisionCubes($this, $this->boundingBox->getOffsetBoundingBox($dx, -1, 0))) === 0; $movX = $dx){
if($dx < $mov and $dx >= -$mov){
$dx = 0;
}elseif($dx > 0){
$dx -= $mov;
}else{
$dx += $mov;
}
}
}
for(; $dz != 0.0 and count($this->getLevel()->getCollisionCubes($this, $this->boundingBox->getOffsetBoundingBox(0, -1, $dz))) === 0; $movZ = $dz){
if($dz < $mov and $dz >= -$mov){
$dz = 0;
}elseif($dz > 0){
$dz -= $mov;
}else{
$dz += $mov;
for(; $dz != 0.0 and count($this->getLevel()->getCollisionCubes($this, $this->boundingBox->getOffsetBoundingBox(0, -1, $dz))) === 0; $movZ = $dz){
if($dz < $mov and $dz >= -$mov){
$dz = 0;
}elseif($dz > 0){
$dz -= $mov;
}else{
$dz += $mov;
}
}
}
//TODO: big messy loop
}*/
//TODO: big messy loop
}*/
if(count($this->getLevel()->getCollisionCubes($this, $this->boundingBox->getOffsetBoundingBox(0, $dy, 0))) > 0){
$dy = 0;
$dx = 0;
$dz = 0;
}
$fallingFlag = $this->onGround or ($dy != $movY and $movY < 0);
if($dx != 0){
if(count($this->getLevel()->getCollisionCubes($this, $this->boundingBox->getOffsetBoundingBox($dx, 0, 0))) > 0){
$dy = 0;
$dx = 0;
$dz = 0;
}
}
if($dz != 0){
if(count($this->getLevel()->getCollisionCubes($this, $this->boundingBox->getOffsetBoundingBox(0, 0, $dz))) > 0){
$dy = 0;
$dx = 0;
$dz = 0;
}
}
if($movX != $dx or $movZ != $dz or $fallingFlag){
$cx = $dx;
$cy = $dy;
$cz = $dz;
$dx = $movX;
$dy = 0;
$dz = $movZ;
$oldBB = clone $this->boundingBox;
$list = $this->getLevel()->getCollisionCubes($this, $this->boundingBox->getOffsetBoundingBox($movX, $dy, $movZ));
@ -807,7 +780,7 @@ abstract class Entity extends Position implements Metadatable{
$dy = $bb->calculateYOffset($this->boundingBox, $dy);
}
$this->boundingBox->addCoord(0, $dy, 0);
$this->boundingBox->offset(0, $dy, 0);
if($movY != $dy){
$dx = 0;
@ -815,11 +788,13 @@ abstract class Entity extends Position implements Metadatable{
$dz = 0;
}
$fallingFlag = $this->onGround or ($dy != $movY and $movY < 0);
foreach($list as $bb){
$dx = $bb->calculateXOffset($this->boundingBox, $dx);
}
$this->boundingBox->addCoord($dx, 0, 0);
$this->boundingBox->offset($dx, 0, 0);
if($movX != $dx){
$dx = 0;
@ -831,7 +806,7 @@ abstract class Entity extends Position implements Metadatable{
$dz = $bb->calculateZOffset($this->boundingBox, $dz);
}
$this->boundingBox->addCoord(0, 0, $dz);
$this->boundingBox->offset(0, 0, $dz);
if($movZ != $dz){
$dx = 0;
@ -845,49 +820,110 @@ abstract class Entity extends Position implements Metadatable{
$dy = $bb->calculateYOffset($this->boundingBox, $dy);
}
$this->boundingBox->addCoord(0, $dy, 0);
$this->boundingBox->offset(0, $dy, 0);
}
if($cx * $cx + $cz * $cz > $dx * $dx + $dz * $dz){
$dx = $cx;
$dy = $cy;
$dz = $cz;
$this->boundingBox->setBB($oldBB);
if($this->gravity > 0 and $fallingFlag and $this->onGround and ($movX != $dx or $movZ != $dz)){
$cx = $dx;
$cy = $dy;
$cz = $dz;
$dx = $movX;
$dy = $this->gravity;
$dz = $movZ;
$axisalignedbb1 = clone $this->boundingBox;
$this->boundingBox->setBB($axisalignedbb);
$list = $this->getLevel()->getCollisionCubes($this, $this->boundingBox->getOffsetBoundingBox($movX, $dy, $movZ));
foreach($list as $bb){
$dy = $bb->calculateYOffset($this->boundingBox, $dy);
}
if($movY != $dy){
$dx = 0;
$dy = 0;
$dz = 0;
}
foreach($list as $bb){
$dx = $bb->calculateXOffset($this->boundingBox, $dx);
}
$this->boundingBox->offset($dx, 0, 0);
if($movX != $dx){
$dx = 0;
$dy = 0;
$dz = 0;
}
foreach($list as $bb){
$dz = $bb->calculateZOffset($this->boundingBox, $dz);
}
$this->boundingBox->offset(0, 0, $dz);
if($movZ != $dz){
$dx = 0;
$dy = 0;
$dz = 0;
}
if($movY != $dy){
$dx = 0;
$dy = 0;
$dz = 0;
}else{
$dy = -$this->gravity;
foreach($list as $bb){
$dy = $bb->calculateYOffset($this->boundingBox, $dy);
}
$this->boundingBox->offset(0, $dy, 0);
}
if($cx * $cx + $cz * $cz > $dx * $dx + $dz * $dz){
$dx = $cx;
$dy = $cy;
$dz = $cz;
$this->boundingBox->setBB($axisalignedbb1);
}
}
$this->x = ($this->boundingBox->minX + $this->boundingBox->maxX) / 2;
$this->y = $this->boundingBox->minY + $this->height;
$this->z = ($this->boundingBox->minZ + $this->boundingBox->maxZ) / 2;
$this->onGround = $movY != $dy and $movY < 0;
$this->updateFallState($dy, $this->onGround);
if($movX != $dx){
$this->motionX = 0;
}
if($movY != $dy){
$this->motionY = 0;
}
if($movZ != $dz){
$this->motionZ = 0;
}
$this->boundingBox->offset($dx, $dy, $dz);
$this->x += $dx;
$this->y += $dy;
$this->z += $dz;
$cx = $this->x - $ox;
$cy = $this->y - $oy;
$cz = $this->z - $oz;
//TODO: vehicle collision events (first we need to spawn them!)
Timings::$entityMoveTimer->stopTiming();
}
$this->x = ($this->boundingBox->minX + $this->boundingBox->maxX) / 2;
$this->y = $this->boundingBox->minY + $this->height;
$this->z = ($this->boundingBox->minZ + $this->boundingBox->maxZ) / 2;
$this->onGround = $movY != $dy and $movY < 0;
$this->updateFallState($dy, $this->onGround);
if($movX != $dx){
$this->motionX = 0;
}
if($movY != $dy){
$this->motionY = 0;
}
if($movZ != $dz){
$this->motionZ = 0;
}
$this->boundingBox->addCoord($dx, $dy, $dz);
$this->x += $dx;
$this->y += $dy;
$this->z += $dz;
$cx = $this->x - $ox;
$cy = $this->y - $oy;
$cz = $this->z - $oz;
//TODO: vehicle collision events (first we need to spawn them!)
Timings::$entityMoveTimer->stopTiming();
}
/**

53
src/pocketmine/math/AxisAlignedBB.php
View File

@ -75,7 +75,7 @@ class AxisAlignedBB{
return $this;
}
public function expand($x, $y, $z){
public function grow($x, $y, $z){
$vec = clone $this;
$vec->minX -= $x;
$vec->minY -= $y;
@ -87,19 +87,29 @@ class AxisAlignedBB{
return $vec;
}
public function offset($x, $y, $z){
$vec = clone $this;
$vec->minX += $x;
$vec->minY += $y;
$vec->minZ += $z;
$vec->maxX += $x;
$vec->maxY += $y;
$vec->maxZ += $z;
public function expand($x, $y, $z){
$this->minX -= $x;
$this->minY -= $y;
$this->minZ -= $z;
$this->maxX += $x;
$this->maxY += $y;
$this->maxZ += $z;
return $vec;
return $this;
}
public function contract($x, $y, $z){
public function offset($x, $y, $z){
$this->minX += $x;
$this->minY += $y;
$this->minZ += $z;
$this->maxX += $x;
$this->maxY += $y;
$this->maxZ += $z;
return $this;
}
public function shrink($x, $y, $z){
$vec = clone $this;
$vec->minX += $x;
$vec->minY += $y;
@ -111,6 +121,17 @@ class AxisAlignedBB{
return $vec;
}
public function contract($x, $y, $z){
$this->minX += $x;
$this->minY += $y;
$this->minZ += $z;
$this->maxX -= $x;
$this->maxY -= $y;
$this->maxZ -= $z;
return $this;
}
public function setBB(AxisAlignedBB $bb){
return new AxisAlignedBB(
min($this->minX, $bb->minX),
@ -123,7 +144,15 @@ class AxisAlignedBB{
}
public function getOffsetBoundingBox($x, $y, $z){
return new AxisAlignedBB($this->minX + $x, $this->minY + $y, $this->minZ + $z, $this->maxX + $x, $this->maxY + $y, $this->maxZ + $z);
$vec = clone $this;
$vec->minX += $x;
$vec->minY += $y;
$vec->minZ += $z;
$vec->maxX += $x;
$vec->maxY += $y;
$vec->maxZ += $z;
return $vec;
}
public function calculateXOffset(AxisAlignedBB $bb, $x){